Details for 1-Chloro-4-iodobenzene

1-Chloro-4-iodobenzene
Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
CAS NO: |
637-87-6 |
EC NO: |
211-305-5 |
Molecular Formula: |
C6H4ClI |
Molecular Weight: |
238.4534 |
Specification: |
GC≥99.5% |
InChI: |
InChI=1/C6H4ClI/c7-5-1-3-6(8)4-2-5/h1-4H |
Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 1-Chloro-4-iodobenzene
CAS No. 637-87-6
Content: GC≥99.5%
Appearance: white crystal;
Packing: 20kg/drum or on request;
Productivity: 10 Tons/M
|
Uses: |
liquid crystal intermediates |
Synonyms: |
4-Chloroiodobenzene;ethyl hydrazinylacetate;P-CHLOROIODOBENZENE; |
Molecular Structure: |
 |
if you are sourcing 1-Chloro-4-iodobenzene from China ,just feel free to inquire