Details for 2-Iodobenzoic acid

2-Iodobenzoic acid
| Category: |
Organic chemicals and Derivatives/Halogenated derivatives |
|
| CAS NO: |
88-67-5 |
| EC NO: |
201-850-7 |
| Molecular Formula: |
C7H4IO2 |
| Molecular Weight: |
247.0105 |
| Specification: |
HPLC≥99.5% |
| InChI: |
InChI=1/C7H5IO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H,9,10)/p-1 |
| Packing: |
20kg/drum or on request |
Product description:
Chemical Name: 2-Iodobenzoic acid
CAS No. 88-67-5
Content: HPLC≥99.5%
Appearance: white crystal
Packing: 20kg/drum or on request;
Productivity: 5Tons/M
|
| Uses: |
pharmaceutical intermediates |
| Synonyms: |
ACID O-IODOBENZOIC;sodium 2-iodobenzoate;2-iodobenzoate;o-Iodobenzoic acid;2-Iodo benzoic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Iodobenzoic acid from China ,just feel free to inquire