| Category: |
Intermediates/Synthesis material intermediates |
|
| CAS NO: |
40649-36-3 |
| EC NO: |
225-065-4 |
| Molecular Formula: |
C9H16O |
| Molecular Weight: |
140.2227 |
| Specification: |
GC≥99.5% |
| InChI: |
InChI=1/C9H16O/c1-2-3-8-4-6-9(10)7-5-8/h8H,2-7H2,1H3 |
| Packing: |
PTFE barrel or on request |
Product description:
Chemical Name: 4-Propylcyclohexanone
CAS No. 40649-36-3
Content: GC≥99.5%
Appearance: colorless transparent liquid;
Packing: PTFE barrel or on request;
Productivity: 10 Tons/M
|
| Uses: |
liquid crystal intermediates |
| Synonyms: |
4-n-Propylcyclohexanone;5-chloro-2-hydroxy-N-phenylbenzamide;4-Propyl-Cyclohexanone;4-Propylcyclohexanone;p-Propylcyclohexanone; |
| Molecular Structure: |
 |