ChemNet > CAS > 1594-56-5 2,4-Dinitrophenyl thiocyanate
1594-56-5 2,4-Dinitrophenyl thiocyanate
| název výrobku |
2,4-Dinitrophenyl thiocyanate |
| Synonyma |
2,4-Dinitrothiocyanatobenzene |
| Molekulární vzorec |
C7H3N3O4S |
| Molekulová hmotnost |
225.1814 |
| InChI |
InChI=1/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| Registrační číslo CAS |
1594-56-5 |
| EINECS |
216-477-5 |
| Molekulární struktura |
|
| Hustota |
1.62g/cm3 |
| Bod tání |
138-140℃ |
| Bod varu |
368.4°C at 760 mmHg |
| Index lomu |
1.666 |
| Bod vzplanutí |
176.6°C |
| Symbolů nebezpečnosti |
|
| Riziko Codes |
R32:Contact with acids liberates very toxic gas.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
