ChemNet > CAS > 1604-28-0 6-Methyl-3,5-heptadien-2-one
1604-28-0 6-Methyl-3,5-heptadien-2-one
název výrobku |
6-Methyl-3,5-heptadien-2-one |
Synonyma |
3,5-Heptadien-2-one, 6-methyl-; 2-Methylhepta-2,4-dien-6-one; AI3-25071; FEMA No. 3363; Methylheptadienone; 6-Methylhepta-3,5-dien-2-one; (3E)-6-methylhepta-3,5-dien-2-one; (3Z)-6-methylhepta-3,5-dien-2-one |
Molekulární vzorec |
C8H12O |
Molekulová hmotnost |
124.1803 |
InChI |
InChI=1/C8H12O/c1-7(2)5-4-6-8(3)9/h4-6H,1-3H3/b6-4- |
Registrační číslo CAS |
1604-28-0 |
EINECS |
216-507-7 |
Molekulární struktura |
|
Hustota |
0.858g/cm3 |
Bod varu |
193.45°C at 760 mmHg |
Index lomu |
1.453 |
Bod vzplanutí |
68.582°C |
Symbolů nebezpečnosti |
|
Riziko Codes |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|