1128-76-3 Ethyl 3-chlorobenzoate
Produkt-Name |
Ethyl 3-chlorobenzoate |
Englischer Name |
Ethyl 3-chlorobenzoate; 3-Chlorobenzoic acid ethyl ester |
Molekulare Formel |
C9H9ClO2 |
Molecular Weight |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
CAS Registry Number |
1128-76-3 |
EINECS |
214-441-3 |
Molecular Structure |
|
Dichte |
1.185g/cm3 |
Siedepunkt |
243°C at 760 mmHg |
Brechungsindex |
1.522 |
Flammpunkt |
115.2°C |
Dampfdruck |
0.0329mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|