14392-69-9 4-Hydroxynonanophenone
Produkt-Name |
4-Hydroxynonanophenone |
Englischer Name |
4-Hydroxynonanophenone; 4-n-Nonanoylphenol; 1-(4-hydroxyphenyl)nonan-1-one |
Molekulare Formel |
C15H22O2 |
Molecular Weight |
234.334 |
InChI |
InChI=1/C15H22O2/c1-2-3-4-5-6-7-8-15(17)13-9-11-14(16)12-10-13/h9-12,16H,2-8H2,1H3 |
CAS Registry Number |
14392-69-9 |
Molecular Structure |
|
Dichte |
0.997g/cm3 |
Siedepunkt |
379°C at 760 mmHg |
Brechungsindex |
1.512 |
Flammpunkt |
161.8°C |
Dampfdruck |
2.78E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|