15014-25-2 Dibenzyl malonate
Produkt-Name |
Dibenzyl malonate |
Englischer Name |
Dibenzyl malonate; Dibenzylmalonateca; Malonic acid dibenzyl ester~Propanedioic acid dibenzyl ester; 2,5-Dimethyl-3-Hezine-Diol; dibenzyl propanedioate |
Molekulare Formel |
C17H16O4 |
Molecular Weight |
284.3065 |
InChI |
InChI=1/C17H16O4/c18-16(20-12-14-7-3-1-4-8-14)11-17(19)21-13-15-9-5-2-6-10-15/h1-10H,11-13H2 |
CAS Registry Number |
15014-25-2 |
EINECS |
239-099-2 |
Molecular Structure |
|
Dichte |
1.187g/cm3 |
Siedepunkt |
445.3°C at 760 mmHg |
Brechungsindex |
1.562 |
Flammpunkt |
190.8°C |
Dampfdruck |
4.01E-08mmHg at 25°C |
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|