ChemNet > CAS > 1823-44-5 2-(2-Thiazolylazo)-p-cresol
1823-44-5 2-(2-Thiazolylazo)-p-cresol
| Produkt-Name |
2-(2-Thiazolylazo)-p-cresol |
| Englischer Name |
2-(2-Thiazolylazo)-p-cresol; TAC; 4-Methyl-2-(2-thiazolylazo)-phenol; 4-methyl-6-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,4-dien-1-one; (6E)-4-methyl-6-[2-(1,3-thiazol-2-yl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
| Molekulare Formel |
C10H9N3OS |
| Molecular Weight |
219.263 |
| InChI |
InChI=1/C10H9N3OS/c1-7-2-3-9(14)8(6-7)12-13-10-11-4-5-15-10/h2-6H,1H3,(H,11,13)/b12-8+ |
| CAS Registry Number |
1823-44-5 |
| Molecular Structure |
|
| Dichte |
1.357g/cm3 |
| Schmelzpunkt |
127-130℃ |
| Siedepunkt |
464.649°C at 760 mmHg |
| Brechungsindex |
1.681 |
| Flammpunkt |
234.812°C |
| Dampfdruck |
0mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|