ChemNet > CAS > 1823-91-2 alpha-Methylbenzyl cyanide
1823-91-2 alpha-Methylbenzyl cyanide
| Produkt-Name |
alpha-Methylbenzyl cyanide |
| Englischer Name |
alpha-Methylbenzyl cyanide; alpha-Methylphenylacetonitrile; 2-Phenylpropionitrile; 2-phenylpropiononitrile; hydratroponitrile; 2-Phenylpropionitrile (Alpha-); α-Methylphenylacetonitrile; 2-phenylpropanenitrile; (2S)-2-phenylpropanenitrile; (2R)-2-phenylpropanenitrile; 2-(o-tolyl)acetonitrile; 2-methylbenzeneacetonitrile; 2-Phenyl propionitrile |
| Molekulare Formel |
C9H9N |
| Molecular Weight |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-8-4-2-3-5-9(8)6-7-10/h2-5H,6H2,1H3 |
| CAS Registry Number |
1823-91-2 |
| EINECS |
217-354-9 |
| Molecular Structure |
|
| Dichte |
0.994g/cm3 |
| Siedepunkt |
244°C at 760 mmHg |
| Brechungsindex |
1.526 |
| Flammpunkt |
111.3°C |
| Dampfdruck |
0.0311mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|