2571-52-0 Mesitonitrile
Produkt-Name |
Mesitonitrile |
Englischer Name |
Mesitonitrile; 2,4,6-Trimethylbenzonitrile; Cyanomesitylene |
Molekulare Formel |
C10H11N |
Molecular Weight |
145.201 |
InChI |
InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
CAS Registry Number |
2571-52-0 |
Molecular Structure |
|
Dichte |
0.97g/cm3 |
Siedepunkt |
260.3°C at 760 mmHg |
Brechungsindex |
1.521 |
Flammpunkt |
111.3°C |
Dampfdruck |
0.0123mmHg at 25°C |
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|