33892-75-0 5-methoxy-1-tetralone
| Produkt-Name |
5-methoxy-1-tetralone |
| Englischer Name |
5-methoxy-1-tetralone; 5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one |
| Molekulare Formel |
C7H8BrN |
| Molecular Weight |
186.0491 |
| InChI |
InChI=1/C7H8BrN/c1-6-3-2-4-7(5-8)9-6/h2-4H,5H2,1H3 |
| CAS Registry Number |
33892-75-0 |
| EINECS |
251-723-5 |
| Molecular Structure |
|
| Dichte |
1.449g/cm3 |
| Schmelzpunkt |
87-91℃ |
| Siedepunkt |
209.865°C at 760 mmHg |
| Brechungsindex |
1.565 |
| Flammpunkt |
80.724°C |
| Dampfdruck |
0.287mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|