60104-29-2 Clofezone
Produkt-Name |
Clofezone |
Englischer Name |
Clofezone; Clofezone [INN:DCF:JAN]; ANP 3260; Clofexamid und phenylbutazon; Equimolar combination of Clofexamide and Phenylbutazone; Perclustop; Torfamex; UNII-TPT3MH65LD; 2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide - 4-butyl-1,2-diphenylpyrazolidine-3,5-dione (1:1) |
Molekulare Formel |
C33H41ClN4O4 |
Molecular Weight |
593.156 |
InChI |
InChI=1/C19H20N2O2.C14H21ClN2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13/h4-13,17H,2-3,14H2,1H3;5-8H,3-4,9-11H2,1-2H3,(H,16,18) |
CAS Registry Number |
60104-29-2 |
EINECS |
241-466-7 |
Molecular Structure |
|
Siedepunkt |
424.9°C at 760 mmHg |
Flammpunkt |
174.3°C |
Dampfdruck |
2E-07mmHg at 25°C |
|