624-51-1 3-Nonanol
Produkt-Name |
3-Nonanol |
Englischer Name |
3-Nonanol; Ethyl n-hexyl carbinol; nonan-3-ol; (3R)-nonan-3-ol; (3S)-nonan-3-ol |
Molekulare Formel |
C9H20O |
Molecular Weight |
144.2545 |
InChI |
InChI=1/C9H20O/c1-3-5-6-7-8-9(10)4-2/h9-10H,3-8H2,1-2H3/t9-/m0/s1 |
CAS Registry Number |
624-51-1 |
EINECS |
210-850-6 |
Molecular Structure |
|
Dichte |
0.824g/cm3 |
Siedepunkt |
196.6°C at 760 mmHg |
Brechungsindex |
1.43 |
Flammpunkt |
79.5°C |
Dampfdruck |
0.102mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|