ChemNet > CAS > 117-39-5 3,3',4',5,7-pentahydroxyflavone
117-39-5 3,3',4',5,7-pentahydroxyflavone
| product Name |
3,3',4',5,7-pentahydroxyflavone |
| CAS No |
117-39-5 |
| Synonyms |
C.I. 75670; C.I. Natural Yellow 10; Quercetin; 3,3,4,5,7-Pentahydroxyflavone (pract); 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
| Molecular Formula |
C15H10O6 |
| Molecular Weight |
286.2363 |
| InChI |
InChI=1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| EINECS |
204-187-1 |
| Molecular Structure |
|
| Density |
1.654g/cm3 |
| Melting point |
314-317℃ |
| Boiling point |
616.1°C at 760 mmHg |
| Refractive index |
1.767 |
| Flash point |
239.5°C |
| Water solubility |
<0.1 g/100 mL at 21℃ |
| Vapour Pressur |
9.03E-16mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|