| Nama produk |
3,3',4',5,7-pentahydroxyflavone |
| Nama bahasa Inggris |
3,3',4',5,7-pentahydroxyflavone;C.I. 75670; C.I. Natural Yellow 10; Quercetin; 3,3,4,5,7-Pentahydroxyflavone (pract); 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
| MF |
C15H10O6 |
| Berat Molekul |
286.2363 |
| InChI |
InChI=1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| CAS NO |
117-39-5 |
| EINECS |
204-187-1 |
| Struktur Molekul |
|
| Kepadatan |
1.654g/cm3 |
| Titik lebur |
314-317℃ |
| Titik didih |
616.1°C at 760 mmHg |
| Indeks bias |
1.767 |
| Titik nyala |
239.5°C |
| Kelarutan air |
<0.1 g/100 mL at 21℃ |
| Tekanan uap |
9.03E-16mmHg at 25°C |
| Simbol bahaya |
T:Toxic;
|
| Kode Risiko |
R25:Toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Keselamatan Deskripsi |
S28:After contact with skin, wash immediately with plenty of ...;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|