132741-29-8 Difluoromandelicacid
product Name |
Difluoromandelicacid |
CAS No |
132741-29-8 |
Synonyms |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
Molecular Formula |
C8H6F2O3 |
Molecular Weight |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
Molecular Structure |
|
Density |
1.522g/cm3 |
Melting point |
92-94℃ |
Boiling point |
320.7°C at 760 mmHg |
Refractive index |
1.542 |
Flash point |
147.8°C |
Vapour Pressur |
0.000129mmHg at 25°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|