20469-63-0 Dimethoxyiodobenzene
product Name |
Dimethoxyiodobenzene |
CAS No |
20469-63-0 |
Synonyms |
1,3-Dimethoxy-4-iodobenzene; 1-Iodo-2,4-dimethoxybenzene; Benzene, 1-iodo-2,4-dimethoxy-; 2,4-Dimethoxyiodobenzene |
Molecular Formula |
C8H9IO2 |
Molecular Weight |
264.0603 |
InChI |
InChI=1/C8H9IO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
Molecular Structure |
|
Density |
1.655g/cm3 |
Melting point |
37-41℃ |
Boiling point |
284.3°C at 760 mmHg |
Refractive index |
1.572 |
Flash point |
125.7°C |
Vapour Pressur |
0.00515mmHg at 25°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|