ChemNet > CAS > 717-27-1 Methylhydroquinone diacetate
717-27-1 Methylhydroquinone diacetate
| product Name |
Methylhydroquinone diacetate |
| Synonyms |
2,5-Diacetoxytoluene; 2-methylbenzene-1,4-diyl diacetate |
| Molecular Formula |
C11H12O4 |
| Molecular Weight |
208.2106 |
| InChI |
InChI=1/C11H12O4/c1-7-6-10(14-8(2)12)4-5-11(7)15-9(3)13/h4-6H,1-3H3 |
| CAS Registry Number |
717-27-1 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
289.7°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
140.2°C |
| Vapour Pressur |
0.00217mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
