94-46-2 isopentyl benzoate
product Name |
isopentyl benzoate |
CAS No |
94-46-2 |
Synonyms |
Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
Molecular Formula |
C12H16O2 |
Molecular Weight |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
EINECS |
202-334-4 |
Molecular Structure |
|
Density |
0.992g/cm3 |
Boiling point |
260°C at 760 mmHg |
Refractive index |
1.495 |
Flash point |
109.4°C |
Vapour Pressur |
0.0125mmHg at 25°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|