1137-73-1 NN-Anilinediacetic Acid
| Ονομασία του προϊόντος |
NN-Anilinediacetic Acid |
| Αγγλικό όνομα |
NN-Anilinediacetic Acid; NN-Di(carboxymethyl)aniline; N-Phenyliminodiacetic acid; N-(Carboxymethyl)-N-phenylglycine; 2,2'-(phenylimino)diacetic acid; 2,2'-(phenylimino)diacetate |
| MF |
C10H9NO4 |
| Μοριακό βάρος |
207.1839 |
| InChI |
InChI=1/C10H11NO4/c12-9(13)6-11(7-10(14)15)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)(H,14,15)/p-2 |
| CAS ΟΧΙ |
1137-73-1 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
451.2°C at 760 mmHg |
| Σημείο ανάφλεξης |
226.7°C |
| Πίεση ατμών |
6.25E-09mmHg at 25°C |
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|