ChemNet > CAS > 392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
Ονομασία του προϊόντος |
Methyl 4-fluoro-2-hydroxybenzoate |
Συνώνυμα |
Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester; Methyl 4-fluoro-2-hydroxybenzoate; 4-Fluoro-6-hydroxy-benzoic acid methyl ester |
MF |
C8H7FO3 |
Μοριακό βάρος |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
CAS ΟΧΙ |
392-04-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.309g/cm3 |
Σημείο βρασμού |
224.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.526 |
Σημείο ανάφλεξης |
89.7°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|