ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
| Ονομασία του προϊόντος |
4-(difluoromethoxy)benzoic acid |
| Συνώνυμα |
4-(difluoromethoxy)benzoate |
| MF |
C8H5F2O3 |
| Μοριακό βάρος |
187.1209 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
| CAS ΟΧΙ |
4837-20-1 |
| Μοριακή δομή |
|
| Σημείο τήξης |
169-171℃ |
| Σημείο βρασμού |
272.1°C at 760 mmHg |
| Σημείο ανάφλεξης |
118.3°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
