ChemNet > CAS > 6320-15-6 6-Chloro-2,4-dimethixypyrimidine
6320-15-6 6-Chloro-2,4-dimethixypyrimidine
| Ονομασία του προϊόντος |
6-Chloro-2,4-dimethixypyrimidine |
| Συνώνυμα |
6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
| MF |
C6H7ClN2O2 |
| Μοριακό βάρος |
174.585 |
| InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
| CAS ΟΧΙ |
6320-15-6 |
| EINECS |
228-669-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.285g/cm3 |
| Σημείο τήξης |
74-76℃ |
| Σημείο βρασμού |
280.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.51 |
| Σημείο ανάφλεξης |
123.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
