ChemNet > CAS > 108078-14-4 2-Iodo-3-methylbenzoic acid
108078-14-4 2-Iodo-3-methylbenzoic acid
termék neve |
2-Iodo-3-methylbenzoic acid |
Angol név |
2-Iodo-3-methylbenzoic acid; 2-Iodo-m-toluic acid |
MF |
C8H7IO2 |
Molekulatömeg |
262.0444 |
InChI |
InChI=1/C8H7IO2/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4H,1H3,(H,10,11) |
CAS-szám |
108078-14-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.867g/cm3 |
Forráspont |
323.5°C at 760 mmHg |
Törésmutató |
1.645 |
Gyulladáspont |
149.5°C |
Gőznyomás |
0.000107mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|