ChemNet > CAS > 111969-64-3 (1S)-(+)-Menthyl glyoxylate hydrate
111969-64-3 (1S)-(+)-Menthyl glyoxylate hydrate
| termék neve |
(1S)-(+)-Menthyl glyoxylate hydrate |
| Angol név |
(1S)-(+)-Menthyl glyoxylate hydrate; Glyoxylic acid (1S)-menthyl ester hydrate; (1r,2s,5r)-5-methyl-2-(1-methylethyl)cyclohexyl dihydroxy-acetate; 2,2-dihydroxyacetic acid (-)-menthyl ester; l-mgh; L-Menthyl glyoxylate hydrate; (1S,2R,5S)-5-methyl-2-(1-methylethyl)cyclohexyl dihydroxyacetate |
| MF |
C12H22O4 |
| Molekulatömeg |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-7(2)9-5-4-8(3)6-10(9)16-12(15)11(13)14/h7-11,13-14H,4-6H2,1-3H3/t8-,9+,10-/m0/s1 |
| CAS-szám |
111969-64-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.09g/cm3 |
| Forráspont |
319.6°C at 760 mmHg |
| Törésmutató |
1.487 |
| Gyulladáspont |
112.9°C |
| Gőznyomás |
2.74E-05mmHg at 25°C |
| Kockázatot kódok |
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Biztonsági Leírás |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|