13861-22-8 Propargyl methacrylate
termék neve |
Propargyl methacrylate |
Angol név |
Propargyl methacrylate; Methacrylic acid propargyl ester~2-Propyn-1-yl 2-methylpropenoate; prop-2-yn-1-yl 2-methylprop-2-enoate |
MF |
C7H8O2 |
Molekulatömeg |
124.1372 |
InChI |
InChI=1/C7H8O2/c1-4-5-9-7(8)6(2)3/h1H,2,5H2,3H3 |
CAS-szám |
13861-22-8 |
EINECS |
237-599-5 |
Molekuláris szerkezete |
|
Sűrűség |
0.983g/cm3 |
Forráspont |
148.4°C at 760 mmHg |
Törésmutató |
1.445 |
Gyulladáspont |
43.2°C |
Gőznyomás |
4.23mmHg at 25°C |
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|