1780-17-2 2-quinolylmethanol
termék neve |
2-quinolylmethanol |
Angol név |
2-quinolylmethanol; 2-Hydroxymethylquinoline; 2-Quinolinylmethanol; 2-Quinolinemethanol; quinolin-2-ylmethanol |
MF |
C10H9NO |
Molekulatömeg |
159.1846 |
InChI |
InChI=1/C10H9NO/c12-7-9-6-5-8-3-1-2-4-10(8)11-9/h1-6,12H,7H2 |
CAS-szám |
1780-17-2 |
EINECS |
217-225-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.218g/cm3 |
Forráspont |
310.6°C at 760 mmHg |
Törésmutató |
1.667 |
Gyulladáspont |
141.6°C |
Gőznyomás |
0.000255mmHg at 25°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|