ChemNet > CAS > 1942-52-5 2-Diethylaminoethanethiol hydrochloride
1942-52-5 2-Diethylaminoethanethiol hydrochloride
| termék neve |
2-Diethylaminoethanethiol hydrochloride |
| Szinonimák |
diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
| MF |
C6H16NS |
| Molekulatömeg |
134.2624 |
| InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
| CAS-szám |
1942-52-5 |
| EINECS |
217-731-8 |
| Molekuláris szerkezete |
|
| Olvadáspont |
168-175℃ |
| Forráspont |
161.6°C at 760 mmHg |
| Gyulladáspont |
51.5°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
