ChemNet > CAS > 2454-37-7 3-(1-Hydroxyethyl)aniline
2454-37-7 3-(1-Hydroxyethyl)aniline
termék neve |
3-(1-Hydroxyethyl)aniline |
Angol név |
3-(1-Hydroxyethyl)aniline; 1-(3-Aminophenyl)ethanol; 3-Amino-alpha-methylbenzyl alcohol~3-Aminophenyl methyl carbinol~3-(alpha-Hydroxyethyl)aniline; (1R)-1-(3-aminophenyl)ethanol; (1S)-1-(3-aminophenyl)ethanol |
MF |
C8H11NO |
Molekulatömeg |
137.179 |
InChI |
InChI=1/C8H11NO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,9H2,1H3/t6-/m0/s1 |
CAS-szám |
2454-37-7 |
EINECS |
219-525-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.117g/cm3 |
Olvadáspont |
66-70℃ |
Forráspont |
285°C at 760 mmHg |
Törésmutató |
1.592 |
Gyulladáspont |
126.1°C |
Gőznyomás |
0.00135mmHg at 25°C |
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|