ChemNet > CAS > 5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
5400-81-7 ethyl 4-amino-3,5-diiodobenzoate
termék neve |
ethyl 4-amino-3,5-diiodobenzoate |
MF |
C9H9I2NO2 |
Molekulatömeg |
416.9822 |
InChI |
InChI=1/C9H9I2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
CAS-szám |
5400-81-7 |
Molekuláris szerkezete |
|
Sűrűség |
2.191g/cm3 |
Olvadáspont |
148℃ |
Forráspont |
449.1°C at 760 mmHg |
Törésmutató |
1.689 |
Gyulladáspont |
225.4°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|