ChemNet > CAS > 6314-42-7 Thianaphthene-2-carboxamide
6314-42-7 Thianaphthene-2-carboxamide
termék neve |
Thianaphthene-2-carboxamide |
Angol név |
Thianaphthene-2-carboxamide; Benzo[b]thiophene-2-carboxamide; 1-benzothiophene-2-carboxamide |
MF |
C9H7NOS |
Molekulatömeg |
177.223 |
InChI |
InChI=1/C9H7NOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H,(H2,10,11) |
CAS-szám |
6314-42-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.345g/cm3 |
Olvadáspont |
176-178℃ |
Forráspont |
411.5°C at 760 mmHg |
Törésmutató |
1.708 |
Gyulladáspont |
202.6°C |
Gőznyomás |
5.58E-07mmHg at 25°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|