ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
termék neve |
3-amino-4-(methylamino)benzonitrile |
Angol név |
3-amino-4-(methylamino)benzonitrile; |
MF |
C8H9N3 |
Molekulatömeg |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
CAS-szám |
64910-46-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.155g/cm3 |
Olvadáspont |
136℃ |
Forráspont |
346.783°C at 760 mmHg |
Törésmutató |
1.593 |
Gyulladáspont |
163.529°C |
Gőznyomás |
0mmHg at 25°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|