ChemNet > CAS > 24566-79-8 N-(6-Bromohexyl)phthalimide
24566-79-8 N-(6-Bromohexyl)phthalimide
| Nama produk |
N-(6-Bromohexyl)phthalimide |
| Nama bahasa Inggris |
N-(6-Bromohexyl)phthalimide; 6-(N-Phthalimido)hexyl bromide; 2-(6-bromohexyl)-1H-isoindole-1,3(2H)-dione |
| MF |
C14H16BrNO2 |
| Berat Molekul |
310.1863 |
| InChI |
InChI=1/C14H16BrNO2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10H2 |
| CAS NO |
24566-79-8 |
| Struktur Molekul |
|
| Kepadatan |
1.414g/cm3 |
| Titik didih |
405.2°C at 760 mmHg |
| Indeks bias |
1.582 |
| Titik nyala |
198.9°C |
| Tekanan uap |
8.93E-07mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|