ChemNet > CAS > 2632-10-2 3,4-Dichlorophenacyl bromide
2632-10-2 3,4-Dichlorophenacyl bromide
Nama produk |
3,4-Dichlorophenacyl bromide |
Sinonim |
alpha-Bromo-3,4-dichloroacetophenone; 2-Bromo-3',4'-dichloroacetophenone; 3,4-dichlorophenacylbromide; (2,2-dichloro-1-methylcyclopropyl)benzene; 2-bromo-1-(3,4-dichlorophenyl)ethanone |
MF |
C8H5BrCl2O |
Berat Molekul |
267.9347 |
InChI |
InChI=1/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
CAS NO |
2632-10-2 |
EINECS |
222-734-2 |
Struktur Molekul |
|
Kepadatan |
1.695g/cm3 |
Titik lebur |
54-55℃ |
Titik didih |
338.5°C at 760 mmHg |
Indeks bias |
1.596 |
Titik nyala |
158.5°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|