ChemNet > CAS > 35112-27-7 Ethyl 2,5-dichlorobenzoate
35112-27-7 Ethyl 2,5-dichlorobenzoate
Nama produk |
Ethyl 2,5-dichlorobenzoate |
Nama bahasa Inggris |
Ethyl 2,5-dichlorobenzoate; 2,5-Dichlorobenzoic acid ethyl ester |
MF |
C9H8Cl2O2 |
Berat Molekul |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c1-2-13-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3 |
CAS NO |
35112-27-7 |
EINECS |
252-373-6 |
Struktur Molekul |
|
Kepadatan |
1.305g/cm3 |
Titik didih |
281.4°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
116.8°C |
Tekanan uap |
0.00357mmHg at 25°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|