615-74-7 2-Chloro-5-methylphenol
Nama produk |
2-Chloro-5-methylphenol |
Nama bahasa Inggris |
2-Chloro-5-methylphenol; 4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
MF |
C7H7ClO |
Berat Molekul |
142.58 |
InChI |
InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
CAS NO |
615-74-7 |
EINECS |
210-444-9 |
Struktur Molekul |
|
Kepadatan |
1.215 |
Titik lebur |
45-48℃ |
Titik didih |
196℃ |
Titik nyala |
81℃ |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R21/22:Harmful in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|