934-00-9 3-Methoxycatechol
| Nama produk |
3-Methoxycatechol |
| Nama bahasa Inggris |
3-Methoxycatechol; Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| MF |
C7H8O3 |
| Berat Molekul |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| CAS NO |
934-00-9 |
| EINECS |
213-276-4 |
| Struktur Molekul |
|
| Kepadatan |
1.27g/cm3 |
| Titik lebur |
39-43℃ |
| Titik didih |
268.1°C at 760 mmHg |
| Indeks bias |
1.579 |
| Titik nyala |
119.5°C |
| Tekanan uap |
0.00476mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|