ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
| שם המוצר |
Thiophene-2-thiocarboxamide |
| נרדפות |
Thiophene-2-carbothioamide |
| מולקולרית פורמולה |
C5H5NS2 |
| משקל מולקולרי |
143.2299 |
| InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| מספר CAS |
20300-02-1 |
| מבנה מולקולרי |
|
| צפיפות |
1.357g/cm3 |
| נקודת ההתוך |
106℃ |
| נקודת רתיחה |
259.5°C at 760 mmHg |
| משקל סגולי |
1.701 |
| נקודת הבזק |
110.7°C |
| Hazard סימנים |
 Xi:Irritant;
|
| סיכונים קודי |
R25:Toxic if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
