ChemNet > CAS > 261762-45-2 2-Chloro-3,6-difluorobenzylamine
261762-45-2 2-Chloro-3,6-difluorobenzylamine
שם המוצר |
2-Chloro-3,6-difluorobenzylamine |
נרדפות |
1-(2-chloro-3,6-difluorophenyl)methanamine |
מולקולרית פורמולה |
C7H6ClF2N |
משקל מולקולרי |
177.579 |
InChI |
InChI=1/C7H6ClF2N/c8-7-4(3-11)5(9)1-2-6(7)10/h1-2H,3,11H2 |
מספר CAS |
261762-45-2 |
מבנה מולקולרי |
|
צפיפות |
1.368g/cm3 |
נקודת רתיחה |
210.3°C at 760 mmHg |
משקל סגולי |
1.522 |
נקודת הבזק |
81°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|