ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
שם המוצר |
1,4-cyclohexanedimethanol dibenzoate |
נרדפות |
1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
מולקולרית פורמולה |
C22H24O4 |
משקל מולקולרי |
352.4236 |
InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
מספר CAS |
35541-81-2 |
מבנה מולקולרי |
|
צפיפות |
1.125g/cm3 |
נקודת רתיחה |
472.9°C at 760 mmHg |
משקל סגולי |
1.549 |
נקודת הבזק |
233.7°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|