ChemNet > CAS > 72846-00-5 1-Benzyl-5-phenylbarbituric acid
72846-00-5 1-Benzyl-5-phenylbarbituric acid
שם המוצר |
1-Benzyl-5-phenylbarbituric acid |
שם אנגלי |
1-Benzyl-5-phenylbarbituric acid; 1-Phenylmethyl-5-phenyl-barbituric acid; 1-benzyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione; 1-Benyl-5-phenyl-barbituric acid |
מולקולרית פורמולה |
C17H14N2O3 |
משקל מולקולרי |
294.3047 |
InChI |
InChI=1/C17H14N2O3/c20-15-14(13-9-5-2-6-10-13)16(21)19(17(22)18-15)11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,18,20,22) |
מספר CAS |
72846-00-5 |
EINECS |
276-940-2 |
מבנה מולקולרי |
|
צפיפות |
1.304g/cm3 |
משקל סגולי |
1.621 |
בטיחות תיאור |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|