उत्पाद का नाम |
D(-)-Glucose diethyl mercaptal |
अंग्रेजी नाम |
D(-)-Glucose diethyl mercaptal; D-(-)-Glucose diethyl mercaptal; D-glucose diethyl mercaptal; 6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name); (2R,3R,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name); (2R,3R,4R,5S)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name); (2R,3R,4R,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name); (2R,3R,4S,5S)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name) |
आणविक फार्मूला |
C10H22O5S2 |
आण्विक वजन |
286.4087 |
InChI |
InChI=1/C10H22O5S2/c1-3-16-10(17-4-2)9(15)8(14)7(13)6(12)5-11/h6-15H,3-5H2,1-2H3/t6-,7-,8+,9+/m1/s1 |
कैस रजिस्टी संख्या |
1941-52-2 |
EINECS |
217-728-1 |
आणविक संरचना |
|
घनत्व |
1.357g/cm3 |
गलनांक |
126-128℃ |
उबलने का समय |
570.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.596 |
फ्लैश प्वाइंट |
276.2°C |
वाष्प का दबाव |
2.22E-15mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|