1956-10-1 4-nitrophenyl caprylate
उत्पाद का नाम |
4-nitrophenyl caprylate |
अंग्रेजी नाम |
4-nitrophenyl caprylate; Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester; 4-Nitrophenyl octanoate; 4-nitrophenyl ester |
आणविक फार्मूला |
C14H19NO4 |
आण्विक वजन |
265.305 |
InChI |
InChI=1/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3 |
कैस रजिस्टी संख्या |
1956-10-1 |
आणविक संरचना |
|
घनत्व |
1.115g/cm3 |
उबलने का समय |
378.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.516 |
फ्लैश प्वाइंट |
149.1°C |
वाष्प का दबाव |
6.16E-06mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|