3048-64-4 5-Vinyl-2-norbornene
उत्पाद का नाम |
5-Vinyl-2-norbornene |
अंग्रेजी नाम |
5-Vinyl-2-norbornene; 5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
आण्विक वजन |
C9H8 |
InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
कैस रजिस्टी संख्या |
3048-64-4 |
EINECS |
221-259-8 |
आणविक संरचना |
|
घनत्व |
1.612 |
गलनांक |
-80℃ |
उबलने का समय |
137.909°C |
अपवर्तक सूचकांक |
144.1732 |
फ्लैश प्वाइंट |
1.189g/cm3 |
वाष्प का दबाव |
304 |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|