34824-58-3 2-Bromophenyldioxolane
उत्पाद का नाम |
2-Bromophenyldioxolane |
अंग्रेजी नाम |
2-Bromophenyldioxolane; 2-(2-Bromophenyl)-1,3-dioxolane; 2-Bromobenzaldehyde ethylene acetal |
आणविक फार्मूला |
C9H9BrO2 |
आण्विक वजन |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9H,5-6H2 |
कैस रजिस्टी संख्या |
34824-58-3 |
आणविक संरचना |
|
घनत्व |
1.515g/cm3 |
उबलने का समय |
272.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.564 |
फ्लैश प्वाइंट |
120.8°C |
वाष्प का दबाव |
0.0103mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|