ChemNet > CAS > 37526-88-8 Benzyl tiglate
37526-88-8 Benzyl tiglate
उत्पाद का नाम |
Benzyl tiglate |
समानार्थी |
Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
आणविक फार्मूला |
C12H14O2 |
आण्विक वजन |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
कैस रजिस्टी संख्या |
37526-88-8 |
EINECS |
253-544-8 |
आणविक संरचना |
|
घनत्व |
1.027g/cm3 |
उबलने का समय |
267.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.516 |
फ्लैश प्वाइंट |
135.9°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|