ChemNet > CAS > 53760-27-3 4,4'-Diaminodiphenylamine sulfate
53760-27-3 4,4'-Diaminodiphenylamine sulfate
| उत्पाद का नाम |
4,4'-Diaminodiphenylamine sulfate |
| अंग्रेजी नाम |
4,4'-Diaminodiphenylamine sulfate; 4,4-Diaminophenylamine sulfate; 4,4-Iminodianiline sulfate salt; N-(4-aminophenyl)benzene-1,4-diamine; N-(4-aminophenyl)benzene-1,4-diamine sulfate (1:1); N-(4-Aminophenyl)-1,4-benzenediamine; 4,4-Diamino-Diphenylamine-Sulfate |
| आणविक फार्मूला |
C12H13N3O4S |
| आण्विक वजन |
295.3154 |
| InChI |
InChI=1/C12H13N3.H2O4S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;1-5(2,3)4/h1-8,15H,13-14H2;(H2,1,2,3,4)/p-2 |
| कैस रजिस्टी संख्या |
53760-27-3 |
| EINECS |
258-748-0 |
| आणविक संरचना |
|
| गलनांक |
300℃ |
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|