ChemNet > CAS > 67487-35-8 2,5-Dichlorobenzhydrazide
67487-35-8 2,5-Dichlorobenzhydrazide
उत्पाद का नाम |
2,5-Dichlorobenzhydrazide |
अंग्रेजी नाम |
2,5-Dichlorobenzhydrazide; 2,5-Dichlorobenzoic acid hydrazide; 2,5-dichlorobenzohydrazide |
आणविक फार्मूला |
C7H6Cl2N2O |
आण्विक वजन |
205.0413 |
InChI |
InChI=1/C7H6Cl2N2O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,10H2,(H,11,12) |
कैस रजिस्टी संख्या |
67487-35-8 |
आणविक संरचना |
|
घनत्व |
1.455g/cm3 |
गलनांक |
180-181℃ |
अपवर्तक सूचकांक |
1.605 |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|