ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
| उत्पाद का नाम |
2-Propanone, reaction products with diphenylamine |
| समानार्थी |
Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
| आणविक फार्मूला |
C15H17NO |
| आण्विक वजन |
227.3016 |
| InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
| कैस रजिस्टी संख्या |
68412-48-6 |
| EINECS |
270-192-0 |
| आणविक संरचना |
|
| उबलने का समय |
302°C at 760 mmHg |
| फ्लैश प्वाइंट |
152.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
